CAS 201483-14-9 appears in our catalog under these names: 4-Oxo-4-(2,2,2-trifluoroethoxy)butanoic acid, 95%, 4-Oxo-4-(2,2,2-trifluoroethoxy)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid (CAS 201483-14-9) is a chemical compound with the molecular formula C6H7F3O4 and a molecular weight of 200.11 g/mol. IUPAC name: 4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid. InChIKey: WEFVNIMFBIHCCY-UHFFFAOYSA-N.
| Molecular formula | C6H7F3O4 |
|---|---|
| Molecular weight | 200.11 g/mol |
| IUPAC name | 4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid |
| InChIKey | WEFVNIMFBIHCCY-UHFFFAOYSA-N |
| SMILES | C(CC(=O)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)