CAS 1217545-85-1 is the registry number for 4-Bromo-2-([(2,4-dichlorophenyl)amino]methyl)phenol, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-bromo-2-[(2,4-dichloroanilino)methyl]phenol (CAS 1217545-85-1) is a chemical compound with the molecular formula C13H10BrCl2NO and a molecular weight of 347.0 g/mol. IUPAC name: 4-bromo-2-[(2,4-dichloroanilino)methyl]phenol. InChIKey: LQTUBAYSXXQINR-UHFFFAOYSA-N.
| Molecular formula | C13H10BrCl2NO |
|---|---|
| Molecular weight | 347.0 g/mol |
| IUPAC name | 4-bromo-2-[(2,4-dichloroanilino)methyl]phenol |
| InChIKey | LQTUBAYSXXQINR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NCC2=C(C=CC(=C2)Br)O |
Computed by PubChem (NCBI)