CAS 946426-94-4 is the registry number for 4-(Bromomethyl)-5-cyclopropyl-3-(2,6-dichlorophenyl)isoxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(bromomethyl)-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole (CAS 946426-94-4) is a chemical compound with the molecular formula C13H10BrCl2NO and a molecular weight of 347.0 g/mol. IUPAC name: 4-(bromomethyl)-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole. InChIKey: PNZIYSWKRBYITO-UHFFFAOYSA-N.
| Molecular formula | C13H10BrCl2NO |
|---|---|
| Molecular weight | 347.0 g/mol |
| IUPAC name | 4-(bromomethyl)-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole |
| InChIKey | PNZIYSWKRBYITO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NO2)C3=C(C=CC=C3Cl)Cl)CBr |
Computed by PubChem (NCBI)