Products 1217636-74-2

CAS 1217636-74-2 is the registry number for Threo-n-boc-l-homophenylalanine epoxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-3-phenylpropyl]carbamate (CAS 1217636-74-2) is a chemical compound with the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-3-phenylpropyl]carbamate. InChIKey: QBDJHEUSBYIOGK-KBPBESRZSA-N.

Identity
Molecular formulaC16H23NO3
Molecular weight277.36 g/mol
IUPAC nametert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-3-phenylpropyl]carbamate
InChIKeyQBDJHEUSBYIOGK-KBPBESRZSA-N
SMILESCC(C)(C)OC(=O)N[C@@H](CCC1=CC=CC=C1)[C@@H]2CO2

Computed by PubChem (NCBI)