Products 1217655-15-6
CAS 1217655-15-6 appears in our catalog under these names: Tilidine-d6 Hydrochloride (100μg/ml in Methanol), Tilidine-d6 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
Ethyl (1R,2R)-2-[bis(trideuteriomethyl)amino]-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride (CAS 1217655-15-6) is a chemical compound with the molecular formula C17H24ClNO2 and a molecular weight of 315.9 g/mol. IUPAC name: ethyl (1R,2R)-2-[bis(trideuteriomethyl)amino]-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride. InChIKey: MUWDJVKYGSDUSH-MHKFGTQZSA-N.
| Molecular formula | C17H24ClNO2 |
|---|---|
| Molecular weight | 315.9 g/mol |
| IUPAC name | ethyl (1R,2R)-2-[bis(trideuteriomethyl)amino]-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride |
| InChIKey | MUWDJVKYGSDUSH-MHKFGTQZSA-N |
| SMILES | [2H]C([2H])([2H])N([C@@H]1C=CCC[C@]1(C2=CC=CC=C2)C(=O)OCC)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)
Synonyms:
Tilidine-d6 Hydrochloride