Products 27107-79-5
CAS 27107-79-5 appears in our catalog under these names: Tilidine Hydrochloride (1mg/ml in Acetonitrile), Tilidine Hydrochloride, >95% (HPLC), Tilidine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 10mg, 1mg, 2mg, 5mg.
Ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride (CAS 27107-79-5) is a chemical compound with the molecular formula C17H24ClNO2 and a molecular weight of 309.8 g/mol. IUPAC name: ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride. InChIKey: MUWDJVKYGSDUSH-KALLACGZSA-N.
| Molecular formula | C17H24ClNO2 |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate;hydrochloride |
| InChIKey | MUWDJVKYGSDUSH-KALLACGZSA-N |
| SMILES | CCOC(=O)[C@@]1(CCC=C[C@H]1N(C)C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)