Products 1217689-95-6
CAS 1217689-95-6 appears in our catalog under these names: Lacosamide-d3, >95% (HPLC), (2R)-Lacosamide-d3 (O-methyl-d3), 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g.
(2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide (CAS 1217689-95-6) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 253.31 g/mol. IUPAC name: (2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide. InChIKey: VPPJLAIAVCUEMN-IBIJPGRPSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 253.31 g/mol |
| IUPAC name | (2R)-2-acetamido-N-benzyl-3-(trideuteriomethoxy)propanamide |
| InChIKey | VPPJLAIAVCUEMN-IBIJPGRPSA-N |
| SMILES | [2H]C([2H])([2H])OC[C@H](C(=O)NCC1=CC=CC=C1)NC(=O)C |
Computed by PubChem (NCBI)