CAS 1219042-50-8 is the registry number for rac-Lacosamide-d6. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-2-[(2,2,2-trideuterioacetyl)amino]-3-(trideuteriomethoxy)propanamide (CAS 1219042-50-8) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 256.33 g/mol. IUPAC name: N-benzyl-2-[(2,2,2-trideuterioacetyl)amino]-3-(trideuteriomethoxy)propanamide. InChIKey: VPPJLAIAVCUEMN-WFGJKAKNSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 256.33 g/mol |
| IUPAC name | N-benzyl-2-[(2,2,2-trideuterioacetyl)amino]-3-(trideuteriomethoxy)propanamide |
| InChIKey | VPPJLAIAVCUEMN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC(COC([2H])([2H])[2H])C(=O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)