Products 1217704-63-6
CAS 1217704-63-6 appears in our catalog under these names: N-Acetyl-d3 Adamantamine, >95% (HPLC), N–Acetyl–d3 Adamantamine, N-Acetyl Adamantamine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 100mg, 5 mg.
N-(1-adamantyl)-2,2,2-trideuterioacetamide (CAS 1217704-63-6) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 196.30 g/mol. IUPAC name: N-(1-adamantyl)-2,2,2-trideuterioacetamide. InChIKey: BCVXYGJCDZPKGV-FIBGUPNXSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 196.30 g/mol |
| IUPAC name | N-(1-adamantyl)-2,2,2-trideuterioacetamide |
| InChIKey | BCVXYGJCDZPKGV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)