Products 880-52-4
CAS 880-52-4 appears in our catalog under these names: N-Acetyl Adamantamine, >95% (HPLC), 1–Acetamidoadamantane, N-(1-Adamantyl)acetamide, 1-Acetamidoadamantane, 98% , N-(1-Adamantyl)-acetamide. Offered by: TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 1g, 250mg, 25g, 50g, 10mg, 25mg, 50mg.
N-(1-adamantyl)acetamide (CAS 880-52-4) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: N-(1-adamantyl)acetamide. InChIKey: BCVXYGJCDZPKGV-UHFFFAOYSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | N-(1-adamantyl)acetamide |
| InChIKey | BCVXYGJCDZPKGV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)
Synonyms:
1-Acetamidoadamantane, n-adamantylacetamide, N-1-Adamantylacetamide, Acetamide, N-tricyclo(3.3.1.13,7)dec-1-yl-, N-ACETYL AMANTADINE, Acetamide, N-tricyclo[3.3.1.13,7]dec-1-yl-, N-Tricyclo(3.3.1.13,7)dec-1-ylacetamide, AMANTADINE HYDROCHLORIDE IMPURITY B (EP IMPURITY), AMANTADINE HYDROCHLORIDE IMPURITY B [EP IMPURITY], N-(1-Adamantyl)acetamide