CAS 1217705-78-6 appears in our catalog under these names: (2R,3R)-3-Amino-2-hydroxy-3-(o-tolyl)propanoic acid, 95%, (2R,3R)-3-Amino-2-hydroxy-3-(o-tolyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(2R,3R)-3-amino-2-hydroxy-3-(2-methylphenyl)propanoic acid (CAS 1217705-78-6) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2R,3R)-3-amino-2-hydroxy-3-(2-methylphenyl)propanoic acid. InChIKey: VFZRMUSJGAGTPL-RKDXNWHRSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2R,3R)-3-amino-2-hydroxy-3-(2-methylphenyl)propanoic acid |
| InChIKey | VFZRMUSJGAGTPL-RKDXNWHRSA-N |
| SMILES | CC1=CC=CC=C1[C@H]([C@H](C(=O)O)O)N |
Computed by PubChem (NCBI)