Products 1217706-31-4
CAS 1217706-31-4 appears in our catalog under these names: NAP 226-90-d6, >95% (HPLC), Nap 226-90-d6, Rivastigmine metabolite-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 10 mg.
3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenol (CAS 1217706-31-4) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 171.27 g/mol. IUPAC name: 3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenol. InChIKey: GQZXRLWUYONVCP-MXUURUABSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 171.27 g/mol |
| IUPAC name | 3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenol |
| InChIKey | GQZXRLWUYONVCP-MXUURUABSA-N |
| SMILES | [2H]C([2H])([2H])N([C@@H](C)C1=CC(=CC=C1)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)