Products 194930-03-5
CAS 194930-03-5 appears in our catalog under these names: 3-(1-(Di(methyl-d3)amino)ethyl)phenol, Desethyl(methyl)carbamic acid rivastigmine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
3-[1-[bis(trideuteriomethyl)amino]ethyl]phenol (CAS 194930-03-5) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 171.27 g/mol. IUPAC name: 3-[1-[bis(trideuteriomethyl)amino]ethyl]phenol. InChIKey: GQZXRLWUYONVCP-XERRXZQWSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 171.27 g/mol |
| IUPAC name | 3-[1-[bis(trideuteriomethyl)amino]ethyl]phenol |
| InChIKey | GQZXRLWUYONVCP-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(C(C)C1=CC(=CC=C1)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)