Products 947505-31-9

CAS 947505-31-9 is the registry number for Methyl 1-(4-methoxybenzyl)-5-methyl-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxylate (CAS 947505-31-9) is a chemical compound with the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. IUPAC name: methyl 1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxylate. InChIKey: SOJORPVDHYEPCE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15N3O3
Molecular weight261.28 g/mol
IUPAC namemethyl 1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxylate
InChIKeySOJORPVDHYEPCE-UHFFFAOYSA-N
SMILESCC1=C(N=NN1CC2=CC=C(C=C2)OC)C(=O)OC

Computed by PubChem (NCBI)