Products 1217716-10-3

CAS 1217716-10-3 is the registry number for rac-trans 3’-Acetylthiomethyl Nicotine. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

S-[[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl] ethanethioate (CAS 1217716-10-3) is a chemical compound with the molecular formula C13H18N2OS and a molecular weight of 250.36 g/mol. IUPAC name: S-[[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl] ethanethioate. InChIKey: MTZCQHJDMWOPPV-CHWSQXEVSA-N.

Identity
Molecular formulaC13H18N2OS
Molecular weight250.36 g/mol
IUPAC nameS-[[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl] ethanethioate
InChIKeyMTZCQHJDMWOPPV-CHWSQXEVSA-N
SMILESCC(=O)SC[C@H]1CCN([C@@H]1C2=CN=CC=C2)C

Computed by PubChem (NCBI)