CAS 379728-06-0 is the registry number for N-(2-Methoxy-5-methylphenyl)-4,4-dimethyl-4,5-dihydro-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (CAS 379728-06-0) is a chemical compound with the molecular formula C13H18N2OS and a molecular weight of 250.36 g/mol. IUPAC name: N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine. InChIKey: BYDDDLOHMINCJR-UHFFFAOYSA-N.
| Molecular formula | C13H18N2OS |
|---|---|
| Molecular weight | 250.36 g/mol |
| IUPAC name | N-(2-methoxy-5-methylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| InChIKey | BYDDDLOHMINCJR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)NC2=NC(CS2)(C)C |
Computed by PubChem (NCBI)