Products 1217724-86-1
CAS 1217724-86-1 is the registry number for N-Boc-phenyl-alaninal-d5. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
Tert-butyl N-[(2S)-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]carbamate (CAS 1217724-86-1) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 254.34 g/mol. IUPAC name: tert-butyl N-[(2S)-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]carbamate. InChIKey: ZJTYRNPLVNMVPQ-GDXCVVTOSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 254.34 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]carbamate |
| InChIKey | ZJTYRNPLVNMVPQ-GDXCVVTOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C=O)NC(=O)OC(C)(C)C)[2H])[2H] |
Computed by PubChem (NCBI)