CAS 1217728-65-8 appears in our catalog under these names: Fmoc-l-2,4-dimethylphenylalanine, 95%, Fmoc–2,4–Dimethyl–L–phenylalanine, Fmoc-L-2,4-dimethylphenylalanine, Fmoc-Phe(2,4-DiMe)-OH 98%, Fmoc-2,4-Dimethyl-L-phenylalanine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg, 1000mg, 100mg, 10g, 25g.
(2S)-3-(2,4-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1217728-65-8) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2S)-3-(2,4-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MXBSNHLSKRVUBF-DEOSSOPVSA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2S)-3-(2,4-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MXBSNHLSKRVUBF-DEOSSOPVSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)