Products 1217737-52-4
CAS 1217737-52-4 is the registry number for (-)-OSU-d7. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
(3S)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(3-methylsulfonylphenyl)piperidine (CAS 1217737-52-4) is a chemical compound with the molecular formula C15H23NO2S and a molecular weight of 288.5 g/mol. IUPAC name: (3S)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(3-methylsulfonylphenyl)piperidine. InChIKey: GZVBVBMMNFIXGE-OQSFHDDPSA-N.
| Molecular formula | C15H23NO2S |
|---|---|
| Molecular weight | 288.5 g/mol |
| IUPAC name | (3S)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)-3-(3-methylsulfonylphenyl)piperidine |
| InChIKey | GZVBVBMMNFIXGE-OQSFHDDPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N1CCC[C@H](C1)C2=CC(=CC=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)