CAS 146798-66-5 appears in our catalog under these names: (-)-OSU, PNU-96391/ 99.76% (existing batch purity), (-)-OSU 6162, PNU-96391, (-)-OSU6162. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 2mg, 5mg, 1mg, 25mg, 50mg, 100mg, 500mg.
(3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine (CAS 146798-66-5) is a chemical compound with the molecular formula C15H23NO2S and a molecular weight of 281.4 g/mol. IUPAC name: (3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine. InChIKey: GZVBVBMMNFIXGE-CQSZACIVSA-N.
| Molecular formula | C15H23NO2S |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | (3S)-3-(3-methylsulfonylphenyl)-1-propylpiperidine |
| InChIKey | GZVBVBMMNFIXGE-CQSZACIVSA-N |
| SMILES | CCCN1CCC[C@H](C1)C2=CC(=CC=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)