CAS 1217748-02-1 is the registry number for (R)-Modafinil-d10 Carboxylate Methyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide (CAS 1217748-02-1) is a chemical compound with the molecular formula C13H16N4O and a molecular weight of 244.29 g/mol. IUPAC name: 2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide. InChIKey: JNAHVYVRKWKWKQ-ZDUSSCGKSA-N.
| Molecular formula | C13H16N4O |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide |
| InChIKey | JNAHVYVRKWKWKQ-ZDUSSCGKSA-N |
| SMILES | C[C@]1(CCCN1)C2=NC3=C(C=CC=C3N2)C(=O)N |
Computed by PubChem (NCBI)