CAS 1217765-02-0 appears in our catalog under these names: Menthol-d4 (mixture of diastereomers), Menthol-d4, D4-Menthol, Concentration: 100 µg/ml Solvent: Methanol. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 2,5mg, 25mg, 25 mg, 100 mg, 2.5 mg, 1x1ml.
1,2,2,6-tetradeuterio-3-methyl-6-propan-2-ylcyclohexan-1-ol (CAS 1217765-02-0) is a chemical compound with the molecular formula C10H20O and a molecular weight of 160.29 g/mol. IUPAC name: 1,2,2,6-tetradeuterio-3-methyl-6-propan-2-ylcyclohexan-1-ol. InChIKey: NOOLISFMXDJSKH-JKQVIGAJSA-N.
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 160.29 g/mol |
| IUPAC name | 1,2,2,6-tetradeuterio-3-methyl-6-propan-2-ylcyclohexan-1-ol |
| InChIKey | NOOLISFMXDJSKH-JKQVIGAJSA-N |
| SMILES | [2H]C1(C(CCC(C1([2H])O)([2H])C(C)C)C)[2H] |
Computed by PubChem (NCBI)