Products 1217770-71-2
CAS 1217770-71-2 appears in our catalog under these names: (S)-Norfluoxetine-d5 (Phenyl-d5), >95% (HPLC), (S)-Norfluoxetine-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(3S)-3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine (CAS 1217770-71-2) is a chemical compound with the molecular formula C16H16F3NO and a molecular weight of 300.33 g/mol. IUPAC name: (3S)-3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine. InChIKey: WIQRCHMSJFFONW-KPSZHSGHSA-N.
| Molecular formula | C16H16F3NO |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | (3S)-3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| InChIKey | WIQRCHMSJFFONW-KPSZHSGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@H](CCN)OC2=CC=C(C=C2)C(F)(F)F)[2H])[2H] |
Computed by PubChem (NCBI)