CAS 130194-43-3 appears in our catalog under these names: (R)-Norfluoxetine, >95% (HPLC), (gammaR)-gamma-(4-(Trifluoromethyl)Phenoxy)-Benzenepropanamine, (R)-Norfluoxetine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 10mg, 2.5 mg.
(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine (CAS 130194-43-3) is a chemical compound with the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. IUPAC name: (3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine. InChIKey: WIQRCHMSJFFONW-OAHLLOKOSA-N.
| Molecular formula | C16H16F3NO |
|---|---|
| Molecular weight | 295.30 g/mol |
| IUPAC name | (3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| InChIKey | WIQRCHMSJFFONW-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCN)OC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)