Products 1217806-82-0

CAS 1217806-82-0 is the registry number for rel-(2R,4S)-4-Phenylpyrrolidine-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,4S)-4-phenylpyrrolidine-2-carboxylic acid (CAS 1217806-82-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (2R,4S)-4-phenylpyrrolidine-2-carboxylic acid. InChIKey: JHHOFXBPLJDHOR-NXEZZACHSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC name(2R,4S)-4-phenylpyrrolidine-2-carboxylic acid
InChIKeyJHHOFXBPLJDHOR-NXEZZACHSA-N
SMILESC1[C@H](CN[C@H]1C(=O)O)C2=CC=CC=C2

Computed by PubChem (NCBI)