CAS 96314-26-0 appears in our catalog under these names: trans-4-Phenyl-L-proline, 98+%, (2S,4S)-4-Phenylpyrrolidine-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2S,4S)-4-phenylpyrrolidine-2-carboxylic acid (CAS 96314-26-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (2S,4S)-4-phenylpyrrolidine-2-carboxylic acid. InChIKey: JHHOFXBPLJDHOR-ZJUUUORDSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (2S,4S)-4-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | JHHOFXBPLJDHOR-ZJUUUORDSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)