CAS 121781-57-5 is the registry number for (3E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one (CAS 121781-57-5) is a chemical compound with the molecular formula C7H9Cl3O2 and a molecular weight of 231.5 g/mol. IUPAC name: (E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one. InChIKey: BGHXUMZQYBZECU-SNAWJCMRSA-N.
| Molecular formula | C7H9Cl3O2 |
|---|---|
| Molecular weight | 231.5 g/mol |
| IUPAC name | (E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one |
| InChIKey | BGHXUMZQYBZECU-SNAWJCMRSA-N |
| SMILES | CCO/C=C(\C)/C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)