CAS 83124-84-9 is the registry number for 1,1,1-Trichloro-4-ethoxy-3-methylbut-3-en-2-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one (CAS 83124-84-9) is a chemical compound with the molecular formula C7H9Cl3O2 and a molecular weight of 231.5 g/mol. IUPAC name: (E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one. InChIKey: BGHXUMZQYBZECU-SNAWJCMRSA-N.
| Molecular formula | C7H9Cl3O2 |
|---|---|
| Molecular weight | 231.5 g/mol |
| IUPAC name | (E)-1,1,1-trichloro-4-ethoxy-3-methylbut-3-en-2-one |
| InChIKey | BGHXUMZQYBZECU-SNAWJCMRSA-N |
| SMILES | CCO/C=C(\C)/C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)