CAS 121781-95-1 appears in our catalog under these names: 1-(4-Aminophenyl)-2-nitroethane, 95%, 1-(4-Aminophenyl)-2-nitroethane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 500mg.
4-(2-nitroethyl)aniline (CAS 121781-95-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4-(2-nitroethyl)aniline. InChIKey: VDABVMSUEPVBJI-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 4-(2-nitroethyl)aniline |
| InChIKey | VDABVMSUEPVBJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC[N+](=O)[O-])N |
Computed by PubChem (NCBI)