CAS 1217828-76-6 appears in our catalog under these names: Calindol-13C,d2 Hydrochloride, Calindol (hydrochloride)-13C,D2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(1R)-N-[dideuterio(1H-indol-2-yl)(113C)methyl]-1-naphthalen-1-ylethanamine;hydrochloride (CAS 1217828-76-6) is a chemical compound with the molecular formula C21H21ClN2 and a molecular weight of 339.9 g/mol. IUPAC name: (1R)-N-[dideuterio(1H-indol-2-yl)(113C)methyl]-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: KFILKQPBQZIRST-XFGGQWPNSA-N.
| Molecular formula | C21H21ClN2 |
|---|---|
| Molecular weight | 339.9 g/mol |
| IUPAC name | (1R)-N-[dideuterio(1H-indol-2-yl)(113C)methyl]-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | KFILKQPBQZIRST-XFGGQWPNSA-N |
| SMILES | [2H][13C]([2H])(C1=CC2=CC=CC=C2N1)N[C@H](C)C3=CC=CC4=CC=CC=C43.Cl |
Computed by PubChem (NCBI)