CAS 729610-18-8 appears in our catalog under these names: Calindol Hydrochloride, Calindol hydrochloride/ 99.47% (existing batch purity), Calindol (hydrochloride), Calindol HCl 98%, Calindol (hydrochloride). Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 50mg, 100mg, 500mg, 250mg.
(1R)-N-(1H-indol-2-ylmethyl)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 729610-18-8) is a chemical compound with the molecular formula C21H21ClN2 and a molecular weight of 336.9 g/mol. IUPAC name: (1R)-N-(1H-indol-2-ylmethyl)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: KFILKQPBQZIRST-XFULWGLBSA-N.
| Molecular formula | C21H21ClN2 |
|---|---|
| Molecular weight | 336.9 g/mol |
| IUPAC name | (1R)-N-(1H-indol-2-ylmethyl)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | KFILKQPBQZIRST-XFULWGLBSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)NCC3=CC4=CC=CC=C4N3.Cl |
Computed by PubChem (NCBI)