Products 1217842-77-7
CAS 1217842-77-7 appears in our catalog under these names: rac alpha-Methadol-d3, rac α-Methadol-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
(3R,6R)-1,1,1-trideuterio-6-(dimethylamino)-4,4-diphenylheptan-3-ol (CAS 1217842-77-7) is a chemical compound with the molecular formula C21H29NO and a molecular weight of 314.5 g/mol. IUPAC name: (3R,6R)-1,1,1-trideuterio-6-(dimethylamino)-4,4-diphenylheptan-3-ol. InChIKey: QIRAYNIFEOXSPW-FULVYNFCSA-N.
| Molecular formula | C21H29NO |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (3R,6R)-1,1,1-trideuterio-6-(dimethylamino)-4,4-diphenylheptan-3-ol |
| InChIKey | QIRAYNIFEOXSPW-FULVYNFCSA-N |
| SMILES | [2H]C([2H])([2H])C[C@H](C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)
Synonyms:
rac ?-Methadol-d3, Alphamethadol-d3