CAS 17199-54-1 is the registry number for Alphamethadol. Offered by: TRC. Available pack sizes: 100mg.
(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol (CAS 17199-54-1) is a chemical compound with the molecular formula C21H29NO and a molecular weight of 311.5 g/mol. IUPAC name: (3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol. InChIKey: QIRAYNIFEOXSPW-YLJYHZDGSA-N.
| Molecular formula | C21H29NO |
|---|---|
| Molecular weight | 311.5 g/mol |
| IUPAC name | (3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol |
| InChIKey | QIRAYNIFEOXSPW-YLJYHZDGSA-N |
| SMILES | CC[C@H](C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)