CAS 1217847-55-6 is the registry number for trans-Ethyl 4-methylpyrrolidine-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl (3S,4S)-4-methylpyrrolidine-3-carboxylate (CAS 1217847-55-6) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: ethyl (3S,4S)-4-methylpyrrolidine-3-carboxylate. InChIKey: TVTNJIINRHALKA-RNFRBKRXSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | ethyl (3S,4S)-4-methylpyrrolidine-3-carboxylate |
| InChIKey | TVTNJIINRHALKA-RNFRBKRXSA-N |
| SMILES | CCOC(=O)[C@@H]1CNC[C@H]1C |
Computed by PubChem (NCBI)