CAS 1217852-55-5 appears in our catalog under these names: 1-((S)-3-Methyl-2-methylamino-butyl)-pyrrolidin-3-ol dihydrochloride, 95%, rel-(S)-1-((S)-3-Methyl-2-(methylamino)butyl)pyrrolidin-3-ol dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
1-[(2S)-3-methyl-2-(methylamino)butyl]pyrrolidin-3-ol;dihydrochloride (CAS 1217852-55-5) is a chemical compound with the molecular formula C10H24Cl2N2O and a molecular weight of 259.21 g/mol. IUPAC name: 1-[(2S)-3-methyl-2-(methylamino)butyl]pyrrolidin-3-ol;dihydrochloride. InChIKey: SGQCMMXWOFMOCR-RBWXRWSZSA-N.
| Molecular formula | C10H24Cl2N2O |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 1-[(2S)-3-methyl-2-(methylamino)butyl]pyrrolidin-3-ol;dihydrochloride |
| InChIKey | SGQCMMXWOFMOCR-RBWXRWSZSA-N |
| SMILES | CC(C)[C@@H](CN1CCC(C1)O)NC.Cl.Cl |
Computed by PubChem (NCBI)