CAS 1260619-57-5 is the registry number for (S,S)-1-(3-Methyl-2-methylamino-butyl)-pyrrolidin-3-ol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(3S)-1-[(2S)-3-methyl-2-(methylamino)butyl]pyrrolidin-3-ol;dihydrochloride (CAS 1260619-57-5) is a chemical compound with the molecular formula C10H24Cl2N2O and a molecular weight of 259.21 g/mol. IUPAC name: (3S)-1-[(2S)-3-methyl-2-(methylamino)butyl]pyrrolidin-3-ol;dihydrochloride. InChIKey: SGQCMMXWOFMOCR-JXGSBULDSA-N.
| Molecular formula | C10H24Cl2N2O |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | (3S)-1-[(2S)-3-methyl-2-(methylamino)butyl]pyrrolidin-3-ol;dihydrochloride |
| InChIKey | SGQCMMXWOFMOCR-JXGSBULDSA-N |
| SMILES | CC(C)[C@@H](CN1CC[C@@H](C1)O)NC.Cl.Cl |
Computed by PubChem (NCBI)