CAS 1217859-15-8 appears in our catalog under these names: (R)-2-(2-Methylbenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%, (R)-2-(2-Methylbenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R)-2-[(2-methylphenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1217859-15-8) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: (2R)-2-[(2-methylphenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: CDBIBJDHAAXDCY-BTQNPOSSSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | (2R)-2-[(2-methylphenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | CDBIBJDHAAXDCY-BTQNPOSSSA-N |
| SMILES | CC1=CC=CC=C1C[C@]2(CCCN2)C(=O)O.Cl |
Computed by PubChem (NCBI)