CAS 1217975-28-4 is the registry number for Pramipexole-d5. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(6S)-6-N-(2,2,3,3,3-pentadeuteriopropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 1217975-28-4) is a chemical compound with the molecular formula C10H17N3S and a molecular weight of 216.36 g/mol. IUPAC name: (6S)-6-N-(2,2,3,3,3-pentadeuteriopropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: FASDKYOPVNHBLU-MCRFZBIBSA-N.
| Molecular formula | C10H17N3S |
|---|---|
| Molecular weight | 216.36 g/mol |
| IUPAC name | (6S)-6-N-(2,2,3,3,3-pentadeuteriopropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | FASDKYOPVNHBLU-MCRFZBIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CN[C@H]1CCC2=C(C1)SC(=N2)N |
Computed by PubChem (NCBI)