Products 1218052-49-3

CAS 1218052-49-3 is the registry number for 2-((3-Methylcyclohexyl)oxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(3-methylcyclohexyl)oxybutanoic acid (CAS 1218052-49-3) is a chemical compound with the molecular formula C11H20O3 and a molecular weight of 200.27 g/mol. IUPAC name: 2-(3-methylcyclohexyl)oxybutanoic acid. InChIKey: TWBGRXXJTOHCNT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20O3
Molecular weight200.27 g/mol
IUPAC name2-(3-methylcyclohexyl)oxybutanoic acid
InChIKeyTWBGRXXJTOHCNT-UHFFFAOYSA-N
SMILESCCC(C(=O)O)OC1CCCC(C1)C

Computed by PubChem (NCBI)