CAS 1218082-92-8 is the registry number for 2-((5-Bromo-2-fluorophenyl)amino)propanamide. Offered by: TRC. Available pack sizes: 100mg.
2-(5-bromo-2-fluoroanilino)propanamide (CAS 1218082-92-8) is a chemical compound with the molecular formula C9H10BrFN2O and a molecular weight of 261.09 g/mol. IUPAC name: 2-(5-bromo-2-fluoroanilino)propanamide. InChIKey: XKDOFYPYNREGTQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFN2O |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 2-(5-bromo-2-fluoroanilino)propanamide |
| InChIKey | XKDOFYPYNREGTQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N)NC1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)