Products 2244517-34-6
CAS 2244517-34-6 is the registry number for 6-Amino-3-bromo-2-fluoro-N,N-dimethylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-3-bromo-2-fluoro-N,N-dimethylbenzamide (CAS 2244517-34-6) is a chemical compound with the molecular formula C9H10BrFN2O and a molecular weight of 261.09 g/mol. IUPAC name: 6-amino-3-bromo-2-fluoro-N,N-dimethylbenzamide. InChIKey: JDJOISSWFHHZBM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFN2O |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 6-amino-3-bromo-2-fluoro-N,N-dimethylbenzamide |
| InChIKey | JDJOISSWFHHZBM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1F)Br)N |
Computed by PubChem (NCBI)