CAS 1218141-42-4 appears in our catalog under these names: Methyl 2-amino-2-(2,4,6-trimethylphenyl)acetate, 95%, Methyl 2-amino-2-(2,4,6-trimethylphenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2-amino-2-(2,4,6-trimethylphenyl)acetate (CAS 1218141-42-4) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: methyl 2-amino-2-(2,4,6-trimethylphenyl)acetate. InChIKey: DJDAFKBODCDJLO-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | methyl 2-amino-2-(2,4,6-trimethylphenyl)acetate |
| InChIKey | DJDAFKBODCDJLO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C(=O)OC)N)C |
Computed by PubChem (NCBI)