CAS 1218351-55-3 is the registry number for 2-Amino-2-mesitylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-2-(2,4,6-trimethylphenyl)acetamide (CAS 1218351-55-3) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 2-amino-2-(2,4,6-trimethylphenyl)acetamide. InChIKey: SMELRSFBWCPUAG-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 2-amino-2-(2,4,6-trimethylphenyl)acetamide |
| InChIKey | SMELRSFBWCPUAG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C(=O)N)N)C |
Computed by PubChem (NCBI)