CAS 1218431-80-1 appears in our catalog under these names: 2-Ethyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid, 95%, 2-Ethyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-ethyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylic acid (CAS 1218431-80-1) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 2-ethyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylic acid. InChIKey: RSQRDVPENVGBIX-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2-ethyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylic acid |
| InChIKey | RSQRDVPENVGBIX-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC2=C(N1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)