CAS 1218657-27-2 is the registry number for 2-(4-Fluorophenyl)-2-(7-oxo-5h-pyrrolo[3,4-b]pyridin-6(7h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-fluorophenyl)-2-(7-oxo-5H-pyrrolo[3,4-b]pyridin-6-yl)acetic acid (CAS 1218657-27-2) is a chemical compound with the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-(7-oxo-5H-pyrrolo[3,4-b]pyridin-6-yl)acetic acid. InChIKey: COJUMNILLDSWCX-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O3 |
|---|---|
| Molecular weight | 286.26 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-(7-oxo-5H-pyrrolo[3,4-b]pyridin-6-yl)acetic acid |
| InChIKey | COJUMNILLDSWCX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)N1C(C3=CC=C(C=C3)F)C(=O)O)N=CC=C2 |
Computed by PubChem (NCBI)