CAS 875424-64-9 is the registry number for Methyl 6-(4-fluorophenyl)-3-methylisoxazolo(5,4-b)pyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (CAS 875424-64-9) is a chemical compound with the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. IUPAC name: methyl 6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate. InChIKey: KJXLRUQPHZFMFD-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O3 |
|---|---|
| Molecular weight | 286.26 g/mol |
| IUPAC name | methyl 6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| InChIKey | KJXLRUQPHZFMFD-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CC=C(C=C3)F)C(=O)OC |
Computed by PubChem (NCBI)