CAS 1218693-48-1 appears in our catalog under these names: trans–2–(4–ethylphenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(4-ethylphenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
Trans-(1R,2R)-2-(4-ethylphenyl)cyclopropane-1-carboxylic acid (CAS 1218693-48-1) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1R,2R)-2-(4-ethylphenyl)cyclopropane-1-carboxylic acid. InChIKey: SALSHFOAPVYIEB-WDEREUQCSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-ethylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | SALSHFOAPVYIEB-WDEREUQCSA-N |
| SMILES | CCC1=CC=C(C=C1)[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)