CAS 1218789-48-0 appears in our catalog under these names: 3-Bromo-5-isobutoxyphenylboronic acid, pinacol ester, 98%, 2-(3-Bromo-5-isobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 100g.
2-[3-bromo-5-(2-methylpropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1218789-48-0) is a chemical compound with the molecular formula C16H24BBrO3 and a molecular weight of 355.1 g/mol. IUPAC name: 2-[3-bromo-5-(2-methylpropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VVMZHSGGZYYKRX-UHFFFAOYSA-N.
| Molecular formula | C16H24BBrO3 |
|---|---|
| Molecular weight | 355.1 g/mol |
| IUPAC name | 2-[3-bromo-5-(2-methylpropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VVMZHSGGZYYKRX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)OCC(C)C |
Computed by PubChem (NCBI)