CAS 1218790-35-2 appears in our catalog under these names: 3-Bromo-5-butoxyphenylboronic acid, pinacol ester, 96%, 2-(3-Bromo-5-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
2-(3-bromo-5-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1218790-35-2) is a chemical compound with the molecular formula C16H24BBrO3 and a molecular weight of 355.1 g/mol. IUPAC name: 2-(3-bromo-5-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KXZBSOUMYLRMPM-UHFFFAOYSA-N.
| Molecular formula | C16H24BBrO3 |
|---|---|
| Molecular weight | 355.1 g/mol |
| IUPAC name | 2-(3-bromo-5-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KXZBSOUMYLRMPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)OCCCC |
Computed by PubChem (NCBI)