CAS 1218789-96-8 appears in our catalog under these names: 3-Acetamido-4-carboxyphenylboronic acid, pinacol ester, 97%, 2-Acetamido-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-acetamido-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1218789-96-8) is a chemical compound with the molecular formula C15H20BNO5 and a molecular weight of 305.14 g/mol. IUPAC name: 2-acetamido-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: BRFHFUAKKXPWLC-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO5 |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | 2-acetamido-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | BRFHFUAKKXPWLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)